| MolName | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide |
| MolecularFormula | C17H12N4OCl2 |
| Smiles | O=C(c1cc(-c2ccccc2)n[nH]1)N/N=C\c(cc1)cc(Cl)c1Cl |
| InChI | InChI=1S/C17H12Cl2N4O/c18-13-7-6-11(8-14(13)19)10-20-23-17(24)16-9-15(21-22-16)12-4-2-1-3-5-12/h1-10H,(H,21,22)(H,23,24) |
| InChIK | DIUCMJIBFRGSQE-UHFFFAOYSA-N |
| TotalMolweight | 359.215 |
| Molweight | 359.215 |
| MonoisotopicMass | 358.038815 |
| CLogP | 4.1114 |
| CLogS | -5.568 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 265.92 |
| Relative PSA | 0.22928 |
| PolarSurfaceArea | 70.14 |
| Druglikeness | 5.6554 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide | 2 - N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide