| MolName | 6-phenyl-N-[(Z)-(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-amine |
| MolecularFormula | C25H22N6S3 |
| Smiles | C(CC1)CCN1c1nc(-c2cccs2)c(/C=N\Nc2c(cc(-c3ccccc3)s3)c3ncn2)s1 |
| InChI | InChI=1S/C25H22N6S3/c1-3-8-17(9-4-1)20-14-18-23(26-16-27-24(18)33-20)30-28-15-21-22(19-10-7-13-32-19)29-25(34-21)31-11-5-2-6-12-31/h1,3-4,7-10,13-16H,2,5-6,11-12H2,(H,26,27,30) |
| InChIK | DIVJZXFRKJJZTB-UHFFFAOYSA-N |
| TotalMolweight | 502.69 |
| Molweight | 502.69 |
| MonoisotopicMass | 502.106804 |
| CLogP | 8.877 |
| CLogS | -9.277 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 373.06 |
| Relative PSA | 0.32303 |
| PolarSurfaceArea | 151.02 |
| Druglikeness | 4.6569 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 6-phenyl-N-[(Z)-(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-amine | 2 - 6-phenyl-N-[(Z)-(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-amine