| MolName | N,N'-bis[(Z)-(4-chlorophenyl)methylideneamino]decanediamide |
| MolecularFormula | C24H28N4O2Cl2 |
| Smiles | O=C(CCCCCCCCC(N/N=C\c(cc1)ccc1Cl)=O)N/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C24H28Cl2N4O2/c25-21-13-9-19(10-14-21)17-27-29-23(31)7-5-3-1-2-4-6-8-24(32)30-28-18-20-11-15-22(26)16-12-20/h9-18H,1-8H2,(H,29,31)(H,30,32) |
| InChIK | DJCQEMKSGIGGQZ-UHFFFAOYSA-N |
| TotalMolweight | 475.418 |
| Molweight | 475.418 |
| MonoisotopicMass | 474.15893 |
| CLogP | 7.3856 |
| CLogS | -7.75 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 381.88 |
| Relative PSA | 0.18859 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | -4.103 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.8125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 13 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 18 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(4-chlorophenyl)methylideneamino]decanediamide | 2 - N,N'-bis[(Z)-(4-chlorophenyl)methylideneamino]decanediamide