| MolName | 2-[2-bromo-4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]-1-morpholin-4-ylethanone |
| MolecularFormula | C15H16N5O3Br |
| Smiles | O=C(COc(ccc(/C=N\n1cnnc1)c1)c1Br)N1CCOCC1 |
| InChI | InChI=1S/C15H16BrN5O3/c16-13-7-12(8-19-21-10-17-18-11-21)1-2-14(13)24-9-15(22)20-3-5-23-6-4-20/h1-2,7-8,10-11H,3-6,9H2 |
| InChIK | DJDQVLPMCGCJLV-UHFFFAOYSA-N |
| TotalMolweight | 394.228 |
| Molweight | 394.228 |
| MonoisotopicMass | 393.043651 |
| CLogP | 1.2027 |
| CLogS | -4.634 |
| H Acceptors | 8 |
| TotalSurfaceArea | 266.48 |
| Relative PSA | 0.28861 |
| PolarSurfaceArea | 81.84 |
| Druglikeness | 3.7133 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-bromo-4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]-1-morpholin-4-ylethanone | 2 - 2-[2-bromo-4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]-1-morpholin-4-ylethanone