| MolName | 4-[(2Z)-2-[[4-(3-chlorobenzoyl)oxyphenyl]methylidene]hydrazinyl]benzoic acid |
| MolecularFormula | C21H15N2O4Cl |
| Smiles | OC(c(cc1)ccc1N/N=C\c(cc1)ccc1OC(c1cccc(Cl)c1)=O)=O |
| InChI | InChI=1S/C21H15ClN2O4/c22-17-3-1-2-16(12-17)21(27)28-19-10-4-14(5-11-19)13-23-24-18-8-6-15(7-9-18)20(25)26/h1-13,24H,(H,25,26) |
| InChIK | DJZSZXWNCAOMDQ-UHFFFAOYSA-N |
| TotalMolweight | 394.813 |
| Molweight | 394.813 |
| MonoisotopicMass | 394.072035 |
| CLogP | 6.3625 |
| CLogS | -5.368 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 296.27 |
| Relative PSA | 0.24353 |
| PolarSurfaceArea | 87.99 |
| Druglikeness | 1.7216 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[[4-(3-chlorobenzoyl)oxyphenyl]methylidene]hydrazinyl]benzoic acid | 2 - 4-[(2Z)-2-[[4-(3-chlorobenzoyl)oxyphenyl]methylidene]hydrazinyl]benzoic acid