| MolName | 4-phenylmethoxy-N-[(Z)-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide |
| MolecularFormula | C37H30N4O3 |
| Smiles | O=C(c(cc1)ccc1OCc1ccccc1)N/N=C\c1cn(-c2ccccc2)nc1-c(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C37H30N4O3/c42-37(31-18-22-35(23-19-31)44-27-29-12-6-2-7-13-29)39-38-24-32-25-41(33-14-8-3-9-15-33)40-36(32)30-16-20-34(21-17-30)43-26-28-10-4-1-5-11-28/h1-25H,26-27H2,(H,39,42) |
| InChIK | DKKNUIDCXGCEFR-UHFFFAOYSA-N |
| TotalMolweight | 578.67 |
| Molweight | 578.67 |
| MonoisotopicMass | 578.231791 |
| CLogP | 6.8168 |
| CLogS | -7.916 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 461.51 |
| Relative PSA | 0.16002 |
| PolarSurfaceArea | 77.74 |
| Druglikeness | 5.5525 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 44 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 11 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 35 |
| Sp3Atoms | 4 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-phenylmethoxy-N-[(Z)-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide | 2 - 4-phenylmethoxy-N-[(Z)-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide