| MolName | 2-[4-bromo-2-[(Z)-[[4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzoyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C25H18N4O4BrClS |
| Smiles | OC(COc(cc1)c(/C=N\NC(c(cc2)ccc2-c2csc(Nc(cc3)ccc3Cl)n2)=O)cc1Br)=O |
| InChI | InChI=1S/C25H18BrClN4O4S/c26-18-5-10-22(35-13-23(32)33)17(11-18)12-28-31-24(34)16-3-1-15(2-4-16)21-14-36-25(30-21)29-20-8-6-19(27)7-9-20/h1-12,14H,13H2,(H,29,30)(H,31,34)(H,32,33) |
| InChIK | DKUKEXAUNLNCSN-UHFFFAOYSA-N |
| TotalMolweight | 585.865 |
| Molweight | 585.865 |
| MonoisotopicMass | 583.992064 |
| CLogP | 6.3283 |
| CLogS | -8.173 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 394.58 |
| Relative PSA | 0.2913 |
| PolarSurfaceArea | 141.15 |
| Druglikeness | 3.9561 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | limit! thiazol-2-ylamine; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63889 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-bromo-2-[(Z)-[[4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzoyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[4-bromo-2-[(Z)-[[4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzoyl]hydrazinylidene]methyl]phenoxy]acetic acid