| MolName | 3-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-one |
| MolecularFormula | C20H11N3O3BrClS |
| Smiles | O=C(c1c(N=C2)scc1-c(cc1)ccc1Cl)N2/N=C\c(cc1OCOc1c1)c1Br |
| InChI | InChI=1S/C20H11BrClN3O3S/c21-15-6-17-16(27-10-28-17)5-12(15)7-24-25-9-23-19-18(20(25)26)14(8-29-19)11-1-3-13(22)4-2-11/h1-9H,10H2 |
| InChIK | DLFMRQRHIGWHLA-UHFFFAOYSA-N |
| TotalMolweight | 488.748 |
| Molweight | 488.748 |
| MonoisotopicMass | 486.9393 |
| CLogP | 5.5478 |
| CLogS | -8.216 |
| H Acceptors | 6 |
| TotalSurfaceArea | 307.1 |
| Relative PSA | 0.2604 |
| PolarSurfaceArea | 91.73 |
| Druglikeness | 3.8372 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-one