| MolName | 4-(benzenesulfonamido)-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide |
| MolecularFormula | C18H15N3O3S2 |
| Smiles | O=C(c(cc1)ccc1NS(c1ccccc1)(=O)=O)N/N=C\c1cccs1 |
| InChI | InChI=1S/C18H15N3O3S2/c22-18(20-19-13-16-5-4-12-25-16)14-8-10-15(11-9-14)21-26(23,24)17-6-2-1-3-7-17/h1-13,21H,(H,20,22) |
| InChIK | DLUWPWNRKNPPLN-UHFFFAOYSA-N |
| TotalMolweight | 385.467 |
| Molweight | 385.467 |
| MonoisotopicMass | 385.055482 |
| CLogP | 3.3673 |
| CLogS | -5.064 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 282.73 |
| Relative PSA | 0.341 |
| PolarSurfaceArea | 124.25 |
| Druglikeness | 0.28501 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(benzenesulfonamido)-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide | 2 - 4-(benzenesulfonamido)-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide