| MolName | N,N'-bis[(Z)-(2,4-dichlorophenyl)methylideneamino]pentanediamide |
| MolecularFormula | C19H16N4O2Cl4 |
| Smiles | O=C(CCCC(N/N=C\c(ccc(Cl)c1)c1Cl)=O)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C19H16Cl4N4O2/c20-14-6-4-12(16(22)8-14)10-24-26-18(28)2-1-3-19(29)27-25-11-13-5-7-15(21)9-17(13)23/h4-11H,1-3H2,(H,26,28)(H,27,29) |
| InChIK | DMLPHPLQJKSBAU-UHFFFAOYSA-N |
| TotalMolweight | 474.174 |
| Molweight | 474.174 |
| MonoisotopicMass | 472.002734 |
| CLogP | 6.3256 |
| CLogS | -7.872 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 343.92 |
| Relative PSA | 0.20941 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | -1.223 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72414 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 14 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(2,4-dichlorophenyl)methylideneamino]pentanediamide | 2 - N,N'-bis[(Z)-(2,4-dichlorophenyl)methylideneamino]pentanediamide