| MolName | (Z)-1,1-diphenyl-N-[(Z)-thiophen-3-ylmethylideneamino]methanimine |
| MolecularFormula | C18H14N2S |
| Smiles | C(c1cscc1)=N\N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H14N2S/c1-3-7-16(8-4-1)18(17-9-5-2-6-10-17)20-19-13-15-11-12-21-14-15/h1-14H |
| InChIK | DOAOFJDPQWHLQW-UHFFFAOYSA-N |
| TotalMolweight | 290.389 |
| Molweight | 290.389 |
| MonoisotopicMass | 290.087768 |
| CLogP | 5.7667 |
| CLogS | -5.808 |
| H Acceptors | 2 |
| TotalSurfaceArea | 236.45 |
| Relative PSA | 0.18346 |
| PolarSurfaceArea | 52.96 |
| Druglikeness | 2.275 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.52381 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1,1-diphenyl-N-[(Z)-thiophen-3-ylmethylideneamino]methanimine | 2 - (Z)-1,1-diphenyl-N-[(Z)-thiophen-3-ylmethylideneamino]methanimine