| MolName | N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-3,4-dichlorobenzamide |
| MolecularFormula | C18H10N3O4BrCl2 |
| Smiles | [O-][N+](c(cc1)cc(Br)c1-c1ccc(/C=N\NC(c(cc2)cc(Cl)c2Cl)=O)o1)=O |
| InChI | InChI=1S/C18H10BrCl2N3O4/c19-14-8-11(24(26)27)2-4-13(14)17-6-3-12(28-17)9-22-23-18(25)10-1-5-15(20)16(21)7-10/h1-9H,(H,23,25) |
| InChIK | DOIRUQZCLQCNLM-UHFFFAOYSA-N |
| TotalMolweight | 483.104 |
| Molweight | 483.104 |
| MonoisotopicMass | 480.923172 |
| CLogP | 5.1561 |
| CLogS | -7.947 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 309.58 |
| Relative PSA | 0.26016 |
| PolarSurfaceArea | 100.42 |
| Druglikeness | -0.37626 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-3,4-dichlorobenzamide | 2 - N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-3,4-dichlorobenzamide