| MolName | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(4-bromophenyl)-1,3-dihydroisoindole-5-carboxamide |
| MolecularFormula | C23H18N3O3Br |
| Smiles | O=C(c1cc(CN(C2)c(cc3)ccc3Br)c2cc1)N/N=C/c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C23H18BrN3O3/c24-19-4-6-20(7-5-19)27-12-17-3-2-16(10-18(17)13-27)23(28)26-25-11-15-1-8-21-22(9-15)30-14-29-21/h1-11H,12-14H2,(H,26,28) |
| InChIK | DOKGYNBLCNTQCY-UHFFFAOYSA-N |
| TotalMolweight | 464.318 |
| Molweight | 464.318 |
| MonoisotopicMass | 463.053153 |
| CLogP | 4.5266 |
| CLogS | -6.862 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 309.96 |
| Relative PSA | 0.19215 |
| PolarSurfaceArea | 63.16 |
| Druglikeness | 4.2179 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(4-bromophenyl)-1,3-dihydroisoindole-5-carboxamide | 2 - N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(4-bromophenyl)-1,3-dihydroisoindole-5-carboxamide