| MolName | 5-bromo-N-[(Z)-[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| MolecularFormula | C24H14N3O3BrCl2 |
| Smiles | N#Cc1c(COc(c(Cl)cc(/C=N\NC(c2cc(cc(cc3)Br)c3o2)=O)c2)c2Cl)cccc1 |
| InChI | InChI=1S/C24H14BrCl2N3O3/c25-18-5-6-21-17(9-18)10-22(33-21)24(31)30-29-12-14-7-19(26)23(20(27)8-14)32-13-16-4-2-1-3-15(16)11-28/h1-10,12H,13H2,(H,30,31) |
| InChIK | DOMYLHNAUXKQCZ-UHFFFAOYSA-N |
| TotalMolweight | 543.203 |
| Molweight | 543.203 |
| MonoisotopicMass | 540.959557 |
| CLogP | 6.8281 |
| CLogS | -9.324 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 365.98 |
| Relative PSA | 0.20132 |
| PolarSurfaceArea | 87.62 |
| Druglikeness | -1.5448 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60606 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - 5-bromo-N-[(Z)-[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide | 2 - 5-bromo-N-[(Z)-[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide