| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-naphthalen-1-ylmethylideneamino]-5-phenyltriazole-4-carboxamide |
| MolecularFormula | C22H16N8O2 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cccc3ccccc23)=O)c1-c1ccccc1 |
| InChI | InChI=1S/C22H16N8O2/c23-20-21(28-32-27-20)30-19(15-8-2-1-3-9-15)18(25-29-30)22(31)26-24-13-16-11-6-10-14-7-4-5-12-17(14)16/h1-13H,(H2,23,27)(H,26,31) |
| InChIK | DOTBYDORXAVDAI-UHFFFAOYSA-N |
| TotalMolweight | 424.423 |
| Molweight | 424.423 |
| MonoisotopicMass | 424.139622 |
| CLogP | 4.64 |
| CLogS | -4.812 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 323.56 |
| Relative PSA | 0.35894 |
| PolarSurfaceArea | 137.11 |
| Druglikeness | 1.9983 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-naphthalen-1-ylmethylideneamino]-5-phenyltriazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-naphthalen-1-ylmethylideneamino]-5-phenyltriazole-4-carboxamide