| MolName | (Z)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C24H20N6 |
| Smiles | C(C1c2ccccc2)C(c2ccccc2)=NN1c1ccc(/C=N\n2cnnc2)cc1 |
| InChI | InChI=1S/C24H20N6/c1-3-7-20(8-4-1)23-15-24(21-9-5-2-6-10-21)30(28-23)22-13-11-19(12-14-22)16-27-29-17-25-26-18-29/h1-14,16-18,24H,15H2/t24-/m1/s1 |
| InChIK | DOVCRAKYSCWOOS-XMMPIXPASA-N |
| TotalMolweight | 392.465 |
| Molweight | 392.465 |
| MonoisotopicMass | 392.174944 |
| CLogP | 4.6907 |
| CLogS | -7.243 |
| H Acceptors | 6 |
| TotalSurfaceArea | 310.05 |
| Relative PSA | 0.17862 |
| PolarSurfaceArea | 58.67 |
| Druglikeness | 4.299 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| StereoCenters | 1 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 3 |
| StereoCon | racemate |
Click to Load Molecule:
1 - (Z)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-(1,2,4-triazol-4-yl)methanimine