| MolName | 2-hydroxy-N-[(Z)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]benzamide |
| MolecularFormula | C21H23N3O4 |
| Smiles | Oc(cccc1)c1C(N/N=C\c(cc1)ccc1OCC(N1CCCCC1)=O)=O |
| InChI | InChI=1S/C21H23N3O4/c25-19-7-3-2-6-18(19)21(27)23-22-14-16-8-10-17(11-9-16)28-15-20(26)24-12-4-1-5-13-24/h2-3,6-11,14,25H,1,4-5,12-13,15H2,(H,23,27) |
| InChIK | DPMDSHXMYDEILM-UHFFFAOYSA-N |
| TotalMolweight | 381.431 |
| Molweight | 381.431 |
| MonoisotopicMass | 381.168857 |
| CLogP | 3.2691 |
| CLogS | -3.804 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 300.45 |
| Relative PSA | 0.25196 |
| PolarSurfaceArea | 91.23 |
| Druglikeness | 4.5945 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]benzamide | 2 - 2-hydroxy-N-[(Z)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]benzamide