| MolName | N-[(Z)-(4-bromophenyl)methylideneamino]-N-phenylaniline |
| MolecularFormula | C19H15N2Br |
| Smiles | Brc1ccc(/C=N\N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15BrN2/c20-17-13-11-16(12-14-17)15-21-22(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-15H |
| InChIK | DPONWAQNGOMBGH-UHFFFAOYSA-N |
| TotalMolweight | 351.246 |
| Molweight | 351.246 |
| MonoisotopicMass | 350.041859 |
| CLogP | 5.954 |
| CLogS | -6.56 |
| H Acceptors | 2 |
| TotalSurfaceArea | 246.47 |
| Relative PSA | 0.061103 |
| PolarSurfaceArea | 15.6 |
| Druglikeness | 1.6129 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-bromophenyl)methylideneamino]-N-phenylaniline | 2 - N-[(Z)-(4-bromophenyl)methylideneamino]-N-phenylaniline