| MolName | 2-[(Z)-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile |
| MolecularFormula | C22H14N2OBr2Cl2S |
| Smiles | N#Cc1c(/N=C\c2cc(Br)cc(Br)c2OCc(ccc(Cl)c2)c2Cl)sc2c1CCC2 |
| InChI | InChI=1S/C22H14Br2Cl2N2OS/c23-14-6-13(10-28-22-17(9-27)16-2-1-3-20(16)30-22)21(18(24)7-14)29-11-12-4-5-15(25)8-19(12)26/h4-8,10H,1-3,11H2 |
| InChIK | DPVMCHMHUMOOCX-UHFFFAOYSA-N |
| TotalMolweight | 585.146 |
| Molweight | 585.146 |
| MonoisotopicMass | 581.857059 |
| CLogP | 7.7505 |
| CLogS | -9.394 |
| H Acceptors | 3 |
| TotalSurfaceArea | 354.83 |
| Relative PSA | 0.15622 |
| PolarSurfaceArea | 73.62 |
| Druglikeness | -6.8468 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile | 2 - 2-[(Z)-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile