| MolName | 2-[2-[(Z)-[[2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C25H21N4O4ClS |
| Smiles | OC(COc1c(/C=N\NC(CSc2nc(cccc3)c3n2Cc(cccc2)c2Cl)=O)cccc1)=O |
| InChI | InChI=1S/C25H21ClN4O4S/c26-19-9-3-1-8-18(19)14-30-21-11-5-4-10-20(21)28-25(30)35-16-23(31)29-27-13-17-7-2-6-12-22(17)34-15-24(32)33/h1-13H,14-16H2,(H,29,31)(H,32,33) |
| InChIK | DPYXEOWTZSHUDC-UHFFFAOYSA-N |
| TotalMolweight | 508.985 |
| Molweight | 508.985 |
| MonoisotopicMass | 508.097203 |
| CLogP | 4.242 |
| CLogS | -5.225 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 377.6 |
| Relative PSA | 0.28464 |
| PolarSurfaceArea | 131.11 |
| Druglikeness | 6.1596 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 6 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-[[2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetic acid