| MolName | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
| MolecularFormula | C18H14N5O2BrCl2S |
| Smiles | Nc1nnc(CC(N/N=C\c(cc(cc2)Br)c2OCc(ccc(Cl)c2)c2Cl)=O)s1 |
| InChI | InChI=1S/C18H14BrCl2N5O2S/c19-12-2-4-15(28-9-10-1-3-13(20)6-14(10)21)11(5-12)8-23-24-16(27)7-17-25-26-18(22)29-17/h1-6,8H,7,9H2,(H2,22,26)(H,24,27) |
| InChIK | DQXJJBRMFBBALF-UHFFFAOYSA-N |
| TotalMolweight | 515.218 |
| Molweight | 515.218 |
| MonoisotopicMass | 512.94286 |
| CLogP | 4.6507 |
| CLogS | -6.616 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 335.72 |
| Relative PSA | 0.30853 |
| PolarSurfaceArea | 130.73 |
| Druglikeness | 3.7504 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide | 2 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide