| MolName | 2-[2-[(Z)-[[2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C20H18N4O4S3 |
| Smiles | OC(COc1c(/C=N\NC(CSc2nnc(SCc3ccccc3)s2)=O)cccc1)=O |
| InChI | InChI=1S/C20H18N4O4S3/c25-17(22-21-10-15-8-4-5-9-16(15)28-11-18(26)27)13-30-20-24-23-19(31-20)29-12-14-6-2-1-3-7-14/h1-10H,11-13H2,(H,22,25)(H,26,27) |
| InChIK | DQXYAKADMILAPU-UHFFFAOYSA-N |
| TotalMolweight | 474.585 |
| Molweight | 474.585 |
| MonoisotopicMass | 474.049016 |
| CLogP | 3.473 |
| CLogS | -6.133 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 350.57 |
| Relative PSA | 0.42625 |
| PolarSurfaceArea | 192.61 |
| Druglikeness | 4.9915 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67742 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 11 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-[[2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid