| MolName | 2,6-dichloro-N-[(Z)-9,10-dihydroanthracen-9-ylmethylideneamino]aniline |
| MolecularFormula | C21H16N2Cl2 |
| Smiles | Clc1cccc(Cl)c1N/N=C\C(c1c(C2)cccc1)c1c2cccc1 |
| InChI | InChI=1S/C21H16Cl2N2/c22-19-10-5-11-20(23)21(19)25-24-13-18-16-8-3-1-6-14(16)12-15-7-2-4-9-17(15)18/h1-11,13,18,25H,12H2 |
| InChIK | DRAICWQTPMRZCX-UHFFFAOYSA-N |
| TotalMolweight | 367.278 |
| Molweight | 367.278 |
| MonoisotopicMass | 366.069052 |
| CLogP | 7.0085 |
| CLogS | -6.282 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 272.6 |
| Relative PSA | 0.084263 |
| PolarSurfaceArea | 24.39 |
| Druglikeness | 2.359 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 9 |
| StereoCon |
Click to Load Molecule:
1 - 2,6-dichloro-N-[(Z)-9,10-dihydroanthracen-9-ylmethylideneamino]aniline | 2 - 2,6-dichloro-N-[(Z)-9,10-dihydroanthracen-9-ylmethylideneamino]aniline