| MolName | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]cyclopropanecarboxamide |
| MolecularFormula | C11H10N2OCl2 |
| Smiles | O=C(C1CC1)N/N=C\c(cc1)cc(Cl)c1Cl |
| InChI | InChI=1S/C11H10Cl2N2O/c12-9-4-1-7(5-10(9)13)6-14-15-11(16)8-2-3-8/h1,4-6,8H,2-3H2,(H,15,16) |
| InChIK | DRBAGJBUYPPKMJ-UHFFFAOYSA-N |
| TotalMolweight | 257.119 |
| Molweight | 257.119 |
| MonoisotopicMass | 256.017017 |
| CLogP | 3.2879 |
| CLogS | -4.539 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 184.59 |
| Relative PSA | 0.19508 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 5.7359 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 3 |
| Symmetricatoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3,4-dichlorophenyl)methylideneamino]cyclopropanecarboxamide | 2 - N-[(Z)-(3,4-dichlorophenyl)methylideneamino]cyclopropanecarboxamide