| MolName | 2-benzyl-N,N'-bis[(Z)-(3-nitrophenyl)methylideneamino]propanediamide |
| MolecularFormula | C24H20N6O6 |
| Smiles | [O-][N+](c1cccc(/C=N\NC(C(Cc2ccccc2)C(N/N=C\c2cccc([N+]([O-])=O)c2)=O)=O)c1)=O |
| InChI | InChI=1S/C24H20N6O6/c31-23(27-25-15-18-8-4-10-20(12-18)29(33)34)22(14-17-6-2-1-3-7-17)24(32)28-26-16-19-9-5-11-21(13-19)30(35)36/h1-13,15-16,22H,14H2,(H,27,31)(H,28,32) |
| InChIK | DRDGRRYUAJUXGQ-UHFFFAOYSA-N |
| TotalMolweight | 488.459 |
| Molweight | 488.459 |
| MonoisotopicMass | 488.144434 |
| CLogP | 2.8098 |
| CLogS | -6.603 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 374.32 |
| Relative PSA | 0.35494 |
| PolarSurfaceArea | 174.56 |
| Druglikeness | 0.31997 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 16 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-benzyl-N,N'-bis[(Z)-(3-nitrophenyl)methylideneamino]propanediamide | 2 - 2-benzyl-N,N'-bis[(Z)-(3-nitrophenyl)methylideneamino]propanediamide