| MolName | N-cyclohexyl-N'-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]oxamide |
| MolecularFormula | C16H18N3O2F3 |
| Smiles | O=C(C(N/N=C\c1c(C(F)(F)F)cccc1)=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H18F3N3O2/c17-16(18,19)13-9-5-4-6-11(13)10-20-22-15(24)14(23)21-12-7-2-1-3-8-12/h4-6,9-10,12H,1-3,7-8H2,(H,21,23)(H,22,24) |
| InChIK | DRSRDAZAGYSAFV-UHFFFAOYSA-N |
| TotalMolweight | 341.332 |
| Molweight | 341.332 |
| MonoisotopicMass | 341.135111 |
| CLogP | 2.8392 |
| CLogS | -4.37 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 253.7 |
| Relative PSA | 0.23851 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | -7.7824 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-cyclohexyl-N'-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]oxamide | 2 - N-cyclohexyl-N'-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]oxamide