| MolName | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C30H25N5O2S |
| Smiles | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)N/N=C\c1cc(OCc2ccccc2)ccc1 |
| InChI | InChI=1S/C30H25N5O2S/c36-28(32-31-20-24-13-10-18-27(19-24)37-21-23-11-4-1-5-12-23)22-38-30-34-33-29(25-14-6-2-7-15-25)35(30)26-16-8-3-9-17-26/h1-20H,21-22H2,(H,32,36) |
| InChIK | DRTSMDHCCQOXNO-UHFFFAOYSA-N |
| TotalMolweight | 519.628 |
| Molweight | 519.628 |
| MonoisotopicMass | 519.172895 |
| CLogP | 5.8799 |
| CLogS | -9.757 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 408 |
| Relative PSA | 0.22625 |
| PolarSurfaceArea | 106.7 |
| Druglikeness | 5.1147 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]acetamide | 2 - 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]acetamide