| MolName | 3-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| MolecularFormula | C19H13N5O3S2 |
| Smiles | [O-][N+](c(cc1)ccc1-c(c(/C=N\N(C(CS1)=O)C1=S)c1)nn1-c1ccccc1)=O |
| InChI | InChI=1S/C19H13N5O3S2/c25-17-12-29-19(28)23(17)20-10-14-11-22(15-4-2-1-3-5-15)21-18(14)13-6-8-16(9-7-13)24(26)27/h1-11H,12H2 |
| InChIK | DRVPHFVKRQOHKB-UHFFFAOYSA-N |
| TotalMolweight | 423.476 |
| Molweight | 423.476 |
| MonoisotopicMass | 423.04598 |
| CLogP | 0.9392 |
| CLogS | -5.238 |
| H Acceptors | 8 |
| TotalSurfaceArea | 307.68 |
| Relative PSA | 0.39603 |
| PolarSurfaceArea | 153.7 |
| Druglikeness | -0.70711 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.44828 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one | 2 - 3-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one