| MolName | [(E)-(5-chlorothiophen-2-yl)methylideneamino]urea |
| MolecularFormula | C6H6N3OClS |
| Smiles | NC(N/N=C/c(s1)ccc1Cl)=O |
| InChI | InChI=1S/C6H6ClN3OS/c7-5-2-1-4(12-5)3-9-10-6(8)11/h1-3H,(H3,8,10,11) |
| InChIK | DSEPUMWEHVVIII-UHFFFAOYSA-N |
| TotalMolweight | 203.653 |
| Molweight | 203.653 |
| MonoisotopicMass | 202.992009 |
| CLogP | 1.8126 |
| CLogS | -3.577 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 147.11 |
| Relative PSA | 0.48698 |
| PolarSurfaceArea | 95.72 |
| Druglikeness | 5.5263 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 12 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 2 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(E)-(5-chlorothiophen-2-yl)methylideneamino]urea | 2 - [(E)-(5-chlorothiophen-2-yl)methylideneamino]urea