| MolName | 1-[(Z)-benzylideneamino]-4-(4-phenylphenyl)imidazol-2-amine |
| MolecularFormula | C22H18N4 |
| Smiles | Nc1nc(-c(cc2)ccc2-c2ccccc2)cn1/N=C\c1ccccc1 |
| InChI | InChI=1S/C22H18N4/c23-22-25-21(16-26(22)24-15-17-7-3-1-4-8-17)20-13-11-19(12-14-20)18-9-5-2-6-10-18/h1-16H,(H2,23,25) |
| InChIK | DSIYLHFNUWAILS-UHFFFAOYSA-N |
| TotalMolweight | 338.413 |
| Molweight | 338.413 |
| MonoisotopicMass | 338.153146 |
| CLogP | 4.7202 |
| CLogS | -8.386 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 273.78 |
| Relative PSA | 0.16298 |
| PolarSurfaceArea | 56.2 |
| Druglikeness | 3.8482 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-benzylideneamino]-4-(4-phenylphenyl)imidazol-2-amine | 2 - 1-[(Z)-benzylideneamino]-4-(4-phenylphenyl)imidazol-2-amine