| MolName | N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]-5,6-diphenyl-1,2,4-triazin-3-amine |
| MolecularFormula | C22H12N5F5 |
| Smiles | Fc(c(/C=N\Nc1nnc(-c2ccccc2)c(-c2ccccc2)n1)c(c(F)c1F)F)c1F |
| InChI | InChI=1S/C22H12F5N5/c23-15-14(16(24)18(26)19(27)17(15)25)11-28-31-22-29-20(12-7-3-1-4-8-12)21(30-32-22)13-9-5-2-6-10-13/h1-11H,(H,29,31,32) |
| InChIK | DSKYIAADLLHCJW-UHFFFAOYSA-N |
| TotalMolweight | 441.362 |
| Molweight | 441.362 |
| MonoisotopicMass | 441.101285 |
| CLogP | 6.8227 |
| CLogS | -7.091 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 316.79 |
| Relative PSA | 0.17639 |
| PolarSurfaceArea | 63.06 |
| Druglikeness | 1.0825 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]-5,6-diphenyl-1,2,4-triazin-3-amine | 2 - N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]-5,6-diphenyl-1,2,4-triazin-3-amine