| MolName | 2,4-dinitro-N-[(Z)-2-[1-(4-phenylphenyl)tetrazol-5-yl]ethylideneamino]aniline |
| MolecularFormula | C21H16N8O4 |
| Smiles | [O-][N+](c(cc1)cc([N+]([O-])=O)c1N/N=C\Cc1nnnn1-c(cc1)ccc1-c1ccccc1)=O |
| InChI | InChI=1S/C21H16N8O4/c30-28(31)18-10-11-19(20(14-18)29(32)33)23-22-13-12-21-24-25-26-27(21)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-11,13-14,23H,12H2 |
| InChIK | DSVPDGCKBDDOJF-UHFFFAOYSA-N |
| TotalMolweight | 444.41 |
| Molweight | 444.41 |
| MonoisotopicMass | 444.129452 |
| CLogP | 3.1322 |
| CLogS | -5.625 |
| H Acceptors | 12 |
| H Donors | 1 |
| TotalSurfaceArea | 335.34 |
| Relative PSA | 0.36855 |
| PolarSurfaceArea | 159.63 |
| Druglikeness | -3.5489 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.60606 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2,4-dinitro-N-[(Z)-2-[1-(4-phenylphenyl)tetrazol-5-yl]ethylideneamino]aniline | 2 - 2,4-dinitro-N-[(Z)-2-[1-(4-phenylphenyl)tetrazol-5-yl]ethylideneamino]aniline