| MolName | [1-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate |
| MolecularFormula | C31H22N3O4Cl |
| Smiles | O=C(CNC(c1cccc2ccccc12)=O)N/N=C\c(c1ccccc1cc1)c1OC(c(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C31H22ClN3O4/c32-23-15-12-22(13-16-23)31(38)39-28-17-14-21-7-2-4-10-25(21)27(28)18-34-35-29(36)19-33-30(37)26-11-5-8-20-6-1-3-9-24(20)26/h1-18H,19H2,(H,33,37)(H,35,36) |
| InChIK | DTFVAVRPEUFDSL-UHFFFAOYSA-N |
| TotalMolweight | 535.986 |
| Molweight | 535.986 |
| MonoisotopicMass | 535.129884 |
| CLogP | 6.7106 |
| CLogS | -8.906 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 402.09 |
| Relative PSA | 0.20779 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 5.1016 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate | 2 - [1-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate