| MolName | N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-(4-fluoroanilino)acetamide |
| MolecularFormula | C29H23N4OF |
| Smiles | O=C(CNc(cc1)ccc1F)N/N=C\c(c1c2cccc1)c(-c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C29H23FN4O/c30-22-15-17-23(18-16-22)31-20-28(35)33-32-19-26-25-13-7-8-14-27(25)34(24-11-5-2-6-12-24)29(26)21-9-3-1-4-10-21/h1-19,31H,20H2,(H,33,35) |
| InChIK | DUASTXKBLXZDAF-UHFFFAOYSA-N |
| TotalMolweight | 462.527 |
| Molweight | 462.527 |
| MonoisotopicMass | 462.185589 |
| CLogP | 5.8463 |
| CLogS | -9.449 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 361.88 |
| Relative PSA | 0.15016 |
| PolarSurfaceArea | 58.42 |
| Druglikeness | 4.6689 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-(4-fluoroanilino)acetamide | 2 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-(4-fluoroanilino)acetamide