| MolName | N'-[(Z)-(4-phenylphenyl)methylideneamino]oxamide |
| MolecularFormula | C15H13N3O2 |
| Smiles | NC(C(N/N=C\c(cc1)ccc1-c1ccccc1)=O)=O |
| InChI | InChI=1S/C15H13N3O2/c16-14(19)15(20)18-17-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-10H,(H2,16,19)(H,18,20) |
| InChIK | DUAXGWACGHNSSW-UHFFFAOYSA-N |
| TotalMolweight | 267.287 |
| Molweight | 267.287 |
| MonoisotopicMass | 267.100777 |
| CLogP | 1.7429 |
| CLogS | -4.188 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 213.26 |
| Relative PSA | 0.3016 |
| PolarSurfaceArea | 84.55 |
| Druglikeness | 2.2506 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(4-phenylphenyl)methylideneamino]oxamide | 2 - N'-[(Z)-(4-phenylphenyl)methylideneamino]oxamide