| MolName | N-[(Z)-2-phenylethylideneamino]aniline |
| MolecularFormula | C14H14N2 |
| Smiles | C(/C=N\Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H14N2/c1-3-7-13(8-4-1)11-12-15-16-14-9-5-2-6-10-14/h1-10,12,16H,11H2 |
| InChIK | DUHYMAHVVOSLQY-UHFFFAOYSA-N |
| TotalMolweight | 210.279 |
| Molweight | 210.279 |
| MonoisotopicMass | 210.115698 |
| CLogP | 4.5281 |
| CLogS | -3.036 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 183 |
| Relative PSA | 0.12552 |
| PolarSurfaceArea | 24.39 |
| Druglikeness | 2.1735 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 2 |
| Electronegative Atoms | 2 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-2-phenylethylideneamino]aniline | 2 - N-[(Z)-2-phenylethylideneamino]aniline