| MolName | 4,6-bis(azepan-1-yl)-N-[(Z)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]-1,3,5-triazin-2-amine |
| MolecularFormula | C22H30N8O3 |
| Smiles | [O-][N+](c1ccc(/C=C/C=N\Nc2nc(N3CCCCCC3)nc(N3CCCCCC3)n2)o1)=O |
| InChI | InChI=1S/C22H30N8O3/c31-30(32)19-12-11-18(33-19)10-9-13-23-27-20-24-21(28-14-5-1-2-6-15-28)26-22(25-20)29-16-7-3-4-8-17-29/h9-13H,1-8,14-17H2,(H,24,25,26,27) |
| InChIK | DUNCNWLYQBOQST-UHFFFAOYSA-N |
| TotalMolweight | 454.533 |
| Molweight | 454.533 |
| MonoisotopicMass | 454.244087 |
| CLogP | 4.7381 |
| CLogS | -6.818 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 364.1 |
| Relative PSA | 0.29528 |
| PolarSurfaceArea | 128.5 |
| Druglikeness | -3.3611 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 13 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4,6-bis(azepan-1-yl)-N-[(Z)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]-1,3,5-triazin-2-amine | 2 - 4,6-bis(azepan-1-yl)-N-[(Z)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]-1,3,5-triazin-2-amine