| MolName | N,N'-bis[(Z)-furan-2-ylmethylideneamino]hexanediamide |
| MolecularFormula | C16H18N4O4 |
| Smiles | O=C(CCCCC(N/N=C\c1ccco1)=O)N/N=C\c1ccco1 |
| InChI | InChI=1S/C16H18N4O4/c21-15(19-17-11-13-5-3-9-23-13)7-1-2-8-16(22)20-18-12-14-6-4-10-24-14/h3-6,9-12H,1-2,7-8H2,(H,19,21)(H,20,22) |
| InChIK | DUOJGMBENABMRK-UHFFFAOYSA-N |
| TotalMolweight | 330.343 |
| Molweight | 330.343 |
| MonoisotopicMass | 330.132806 |
| CLogP | 2.7334 |
| CLogS | -4.562 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 275.38 |
| Relative PSA | 0.36401 |
| PolarSurfaceArea | 109.2 |
| Druglikeness | -4.2353 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 4 |
| Symmetricatoms | 12 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-furan-2-ylmethylideneamino]hexanediamide | 2 - N,N'-bis[(Z)-furan-2-ylmethylideneamino]hexanediamide