| MolName | N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]pyridine-3-carboxamide |
| MolecularFormula | C18H20N4O |
| Smiles | O=C(c1cnccc1)N/N=C\c(cc1)ccc1N1CCCCC1 |
| InChI | InChI=1S/C18H20N4O/c23-18(16-5-4-10-19-14-16)21-20-13-15-6-8-17(9-7-15)22-11-2-1-3-12-22/h4-10,13-14H,1-3,11-12H2,(H,21,23) |
| InChIK | DVQCEJVAFCPROU-UHFFFAOYSA-N |
| TotalMolweight | 308.384 |
| Molweight | 308.384 |
| MonoisotopicMass | 308.163711 |
| CLogP | 3.0337 |
| CLogS | -3.918 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 251.35 |
| Relative PSA | 0.20103 |
| PolarSurfaceArea | 57.59 |
| Druglikeness | 4.4118 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]pyridine-3-carboxamide | 2 - N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]pyridine-3-carboxamide