| MolName | 2-[(4-chlorophenyl)sulfonylamino]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C15H12N3O3Cl3S |
| Smiles | O=C(CNS(c(cc1)ccc1Cl)(=O)=O)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C15H12Cl3N3O3S/c16-11-3-5-13(6-4-11)25(23,24)20-9-15(22)21-19-8-10-1-2-12(17)7-14(10)18/h1-8,20H,9H2,(H,21,22) |
| InChIK | DVRVMVTXSIHJPH-UHFFFAOYSA-N |
| TotalMolweight | 420.703 |
| Molweight | 420.703 |
| MonoisotopicMass | 418.966493 |
| CLogP | 3.7899 |
| CLogS | -5.244 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 287.05 |
| Relative PSA | 0.26494 |
| PolarSurfaceArea | 96.01 |
| Druglikeness | 7.5047 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(4-chlorophenyl)sulfonylamino]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]acetamide | 2 - 2-[(4-chlorophenyl)sulfonylamino]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]acetamide