| MolName | N-[(Z)-[3-[4-(difluoromethoxy)phenyl]-1-phenylpyrazol-4-yl]methylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
| MolecularFormula | C29H27N5O4F2S |
| Smiles | O=C(c1cccc(S(N2CCCCC2)(=O)=O)c1)N/N=C\c1cn(-c2ccccc2)nc1-c(cc1)ccc1OC(F)F |
| InChI | InChI=1S/C29H27F2N5O4S/c30-29(31)40-25-14-12-21(13-15-25)27-23(20-36(34-27)24-9-3-1-4-10-24)19-32-33-28(37)22-8-7-11-26(18-22)41(38,39)35-16-5-2-6-17-35/h1,3-4,7-15,18-20,29H,2,5-6,16-17H2,(H,33,37) |
| InChIK | DVSULVNTCNMPOQ-UHFFFAOYSA-N |
| TotalMolweight | 579.626 |
| Molweight | 579.626 |
| MonoisotopicMass | 579.175181 |
| CLogP | 4.4968 |
| CLogS | -5.951 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 423.85 |
| Relative PSA | 0.22645 |
| PolarSurfaceArea | 114.27 |
| Druglikeness | -1.6175 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5122 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 8 |
| Symmetricatoms | 8 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-[4-(difluoromethoxy)phenyl]-1-phenylpyrazol-4-yl]methylideneamino]-3-piperidin-1-ylsulfonylbenzamide | 2 - N-[(Z)-[3-[4-(difluoromethoxy)phenyl]-1-phenylpyrazol-4-yl]methylideneamino]-3-piperidin-1-ylsulfonylbenzamide