| MolName | N-[(Z)-[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| MolecularFormula | C30H35N8OCl |
| Smiles | Clc(cc1)ccc1OCCn1c(cccc2)c2c(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C30H35ClN8O/c31-24-11-13-25(14-12-24)40-20-19-39-22-23(26-9-3-4-10-27(26)39)21-32-36-28-33-29(37-15-5-1-6-16-37)35-30(34-28)38-17-7-2-8-18-38/h3-4,9-14,21-22H,1-2,5-8,15-20H2,(H,33,34,35,36) |
| InChIK | DVZJSWPBWZBGKJ-UHFFFAOYSA-N |
| TotalMolweight | 559.116 |
| Molweight | 559.116 |
| MonoisotopicMass | 558.262234 |
| CLogP | 7.9814 |
| CLogS | -7.198 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 433.22 |
| Relative PSA | 0.18432 |
| PolarSurfaceArea | 83.7 |
| Druglikeness | 3.0029 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.525 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 13 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine | 2 - N-[(Z)-[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine