| MolName | (Z)-1-[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C13H8N4OBrClS |
| Smiles | Clc(cc1)ccc1Sc(oc(/C=N\n1cnnc1)c1)c1Br |
| InChI | InChI=1S/C13H8BrClN4OS/c14-12-5-10(6-18-19-7-16-17-8-19)20-13(12)21-11-3-1-9(15)2-4-11/h1-8H |
| InChIK | DWIMQCUOPJELQO-UHFFFAOYSA-N |
| TotalMolweight | 383.657 |
| Molweight | 383.657 |
| MonoisotopicMass | 381.929069 |
| CLogP | 3.6667 |
| CLogS | -7.111 |
| H Acceptors | 5 |
| TotalSurfaceArea | 245.49 |
| Relative PSA | 0.29297 |
| PolarSurfaceArea | 81.51 |
| Druglikeness | -1.5541 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]-N-(1,2,4-triazol-4-yl)methanimine