| MolName | (Z)-N-(2-fluorophenyl)-4-(furan-2-yl)-3-[(Z)-pyridin-3-ylmethylideneamino]-1,3-thiazol-2-imine |
| MolecularFormula | C19H13N4OFS |
| Smiles | Fc(cccc1)c1/N=C1\SC=C(c2ccco2)N1/N=C\c1cnccc1 |
| InChI | InChI=1S/C19H13FN4OS/c20-15-6-1-2-7-16(15)23-19-24(22-12-14-5-3-9-21-11-14)17(13-26-19)18-8-4-10-25-18/h1-13H |
| InChIK | DWTGSVLMVDDLDD-UHFFFAOYSA-N |
| TotalMolweight | 364.403 |
| Molweight | 364.403 |
| MonoisotopicMass | 364.079409 |
| CLogP | 3.6527 |
| CLogS | -4.835 |
| H Acceptors | 5 |
| TotalSurfaceArea | 274.31 |
| Relative PSA | 0.25205 |
| PolarSurfaceArea | 79.29 |
| Druglikeness | 2.1905 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-(2-fluorophenyl)-4-(furan-2-yl)-3-[(Z)-pyridin-3-ylmethylideneamino]-1,3-thiazol-2-imine | 2 - (Z)-N-(2-fluorophenyl)-4-(furan-2-yl)-3-[(Z)-pyridin-3-ylmethylideneamino]-1,3-thiazol-2-imine