| MolName | 3-[[4-chloro-2-oxo-5-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]-1,3-thiazol-3-yl]methyl]benzoate |
| MolecularFormula | C18H12N4O4ClS |
| Smiles | [O-]C(c1cccc(CN(C(Cl)=C(/C=N\NC(c2ccncc2)=O)S2)C2=O)c1)=O |
| InChI | InChI=1S/C18H13ClN4O4S/c19-15-14(9-21-22-16(24)12-4-6-20-7-5-12)28-18(27)23(15)10-11-2-1-3-13(8-11)17(25)26/h1-9H,10H2,(H,22,24)(H,25,26)/p-1 |
| InChIK | DWTWJHITMQZRLY-UHFFFAOYSA-M |
| TotalMolweight | 415.836 |
| Molweight | 415.836 |
| MonoisotopicMass | 415.026778 |
| CLogP | -0.0199 |
| CLogS | -4.546 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 295.17 |
| Relative PSA | 0.36718 |
| PolarSurfaceArea | 140.09 |
| Druglikeness | 7.456 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | polar activated DB; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[[4-chloro-2-oxo-5-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]-1,3-thiazol-3-yl]methyl]benzoate | 2 - 3-[[4-chloro-2-oxo-5-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]-1,3-thiazol-3-yl]methyl]benzoate