| MolName | 2-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C19H11N7O3Cl2F6 |
| Smiles | [O-][N+](c(cc1)ccc1Nc1nc(N/N=C\c(ccc(Cl)c2)c2Cl)nc(OC(C(F)(F)F)C(F)(F)F)n1)=O |
| InChI | InChI=1S/C19H11Cl2F6N7O3/c20-10-2-1-9(13(21)7-10)8-28-33-16-30-15(29-11-3-5-12(6-4-11)34(35)36)31-17(32-16)37-14(18(22,23)24)19(25,26)27/h1-8,14H,(H2,29,30,31,32,33) |
| InChIK | DXHOWJCSQFGWSF-UHFFFAOYSA-N |
| TotalMolweight | 570.236 |
| Molweight | 570.236 |
| MonoisotopicMass | 569.02046 |
| CLogP | 7.7475 |
| CLogS | -9.021 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 372.67 |
| Relative PSA | 0.28916 |
| PolarSurfaceArea | 130.14 |
| Druglikeness | -14.8 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.48649 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 18 |
| Electronegative Atoms | 18 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine