| MolName | N-[(Z)-furan-2-ylmethylideneamino]-2,2-diphenylacetamide |
| MolecularFormula | C19H16N2O2 |
| Smiles | O=C(C(c1ccccc1)c1ccccc1)N/N=C\c1ccco1 |
| InChI | InChI=1S/C19H16N2O2/c22-19(21-20-14-17-12-7-13-23-17)18(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-14,18H,(H,21,22) |
| InChIK | DXIWOMGLGALFCI-UHFFFAOYSA-N |
| TotalMolweight | 304.348 |
| Molweight | 304.348 |
| MonoisotopicMass | 304.121178 |
| CLogP | 3.916 |
| CLogS | -4.517 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 248.94 |
| Relative PSA | 0.20133 |
| PolarSurfaceArea | 54.6 |
| Druglikeness | 4.8579 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52174 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-furan-2-ylmethylideneamino]-2,2-diphenylacetamide | 2 - N-[(Z)-furan-2-ylmethylideneamino]-2,2-diphenylacetamide