| MolName | 2-[[(Z)-(4-chlorophenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol |
| MolecularFormula | C16H14N3O3ClS |
| Smiles | OCCN(C(c1c2cccc1)=NS2(=O)=O)/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C16H14ClN3O3S/c17-13-7-5-12(6-8-13)11-18-20(9-10-21)16-14-3-1-2-4-15(14)24(22,23)19-16/h1-8,11,21H,9-10H2 |
| InChIK | DXZYHWRIRYVPFD-UHFFFAOYSA-N |
| TotalMolweight | 363.824 |
| Molweight | 363.824 |
| MonoisotopicMass | 363.044439 |
| CLogP | 2.9621 |
| CLogS | -3.751 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 255.42 |
| Relative PSA | 0.26721 |
| PolarSurfaceArea | 90.71 |
| Druglikeness | 5.2608 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[(Z)-(4-chlorophenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol | 2 - 2-[[(Z)-(4-chlorophenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol