| MolName | 3-chloro-N-[(Z)-pyridin-3-ylmethylideneamino]pyrazin-2-amine |
| MolecularFormula | C10H8N5Cl |
| Smiles | Clc1nccnc1N/N=C\c1cnccc1 |
| InChI | InChI=1S/C10H8ClN5/c11-9-10(14-5-4-13-9)16-15-7-8-2-1-3-12-6-8/h1-7H,(H,14,16) |
| InChIK | DYBNZCGBRXDAIO-UHFFFAOYSA-N |
| TotalMolweight | 233.662 |
| Molweight | 233.662 |
| MonoisotopicMass | 233.046822 |
| CLogP | 2.893 |
| CLogS | -1.788 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 180.94 |
| Relative PSA | 0.30883 |
| PolarSurfaceArea | 63.06 |
| Druglikeness | 2.3845 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 3-chloro-N-[(Z)-pyridin-3-ylmethylideneamino]pyrazin-2-amine | 2 - 3-chloro-N-[(Z)-pyridin-3-ylmethylideneamino]pyrazin-2-amine