| MolName | 2,3,5,6-tetrafluoro-N-[(Z)-(4-nitrophenyl)methylideneamino]-4-(trifluoromethyl)aniline |
| MolecularFormula | C14H6N3O2F7 |
| Smiles | [O-][N+](c1ccc(/C=N\Nc(c(F)c(c(C(F)(F)F)c2F)F)c2F)cc1)=O |
| InChI | InChI=1S/C14H6F7N3O2/c15-9-8(14(19,20)21)10(16)12(18)13(11(9)17)23-22-5-6-1-3-7(4-2-6)24(25)26/h1-5,23H |
| InChIK | DYHMZRMRTVBYIQ-UHFFFAOYSA-N |
| TotalMolweight | 381.207 |
| Molweight | 381.207 |
| MonoisotopicMass | 381.034823 |
| CLogP | 5.1708 |
| CLogS | -5.643 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 247.77 |
| Relative PSA | 0.21548 |
| PolarSurfaceArea | 70.21 |
| Druglikeness | -10.322 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 8 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2,3,5,6-tetrafluoro-N-[(Z)-(4-nitrophenyl)methylideneamino]-4-(trifluoromethyl)aniline | 2 - 2,3,5,6-tetrafluoro-N-[(Z)-(4-nitrophenyl)methylideneamino]-4-(trifluoromethyl)aniline